C20H37N3O3 — CID 23380487
3-[(E)-1-hydroxy-2-methylhex-4-enyl]-4,7-dimethyl-6-propan-2-yl-1,4,7-triazacycloundecane-2,5-dione (PubChem CID 23380487) has the molecular formula C20H37N3O3 and a molecular weight of 367.53 g/mol. Its IUPAC name is 3-[(E)-1-hydroxy-2-methylhex-4-enyl]-4,7-dimethyl-6-propan-2-yl-1,4,7-triazacycloundecane-2,5-dione.
| Compound Name | 3-[(E)-1-hydroxy-2-methylhex-4-enyl]-4,7-dimethyl-6-propan-2-yl-1,4,7-triazacycloundecane-2,5-dione |
|---|---|
| PubChem CID | 23380487 |
| Molecular Formula | C20H37N3O3 |
| Molecular Weight | 367.53 g/mol |
| Exact Mass | 367.28 |
| IUPAC Name | 3-[(E)-1-hydroxy-2-methylhex-4-enyl]-4,7-dimethyl-6-propan-2-yl-1,4,7-triazacycloundecane-2,5-dione |
| SMILES | C/C=C/CC(C)C(O)C1C(=O)NCCCCN(C)C(C(C)C)C(=O)N1C |
| InChI | InChI=1S/C20H37N3O3/c1-7-8-11-15(4)18(24)17-19(25)21-12-9-10-13-22(5)16(14(2)3)20(26)23(17)6/h7-8,14-18,24H,9-13H2,1-6H3,(H,21,25)/b8-7+ |
| InChIKey | ZOBBCBSJQDMETE-BQYQJAHWSA-N |
| XLogP | 1.64 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.53 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|