C9H7F3N4S — CID 23380616
8-prop-2-enylsulfanyl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyrazine (PubChem CID 23380616) has the molecular formula C9H7F3N4S and a molecular weight of 260.24 g/mol. Its IUPAC name is 8-prop-2-enylsulfanyl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyrazine.
| Compound Name | 8-prop-2-enylsulfanyl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyrazine |
|---|---|
| PubChem CID | 23380616 |
| Molecular Formula | C9H7F3N4S |
| Molecular Weight | 260.24 g/mol |
| Exact Mass | 260.03 |
| IUPAC Name | 8-prop-2-enylsulfanyl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyrazine |
| SMILES | C=CCSc1nccn2c(C(F)(F)F)nnc12 |
| InChI | InChI=1S/C9H7F3N4S/c1-2-5-17-7-6-14-15-8(9(10,11)12)16(6)4-3-13-7/h2-4H,1,5H2 |
| InChIKey | FURHPIZTRNEPCB-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.24 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|