C11H10F3N5S — CID 23380629
5-isocyano-8-(2-methylpropylsulfanyl)-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyrazine (PubChem CID 23380629) has the molecular formula C11H10F3N5S and a molecular weight of 301.30 g/mol. Its IUPAC name is 5-isocyano-8-(2-methylpropylsulfanyl)-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyrazine.
| Compound Name | 5-isocyano-8-(2-methylpropylsulfanyl)-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyrazine |
|---|---|
| PubChem CID | 23380629 |
| Molecular Formula | C11H10F3N5S |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | 5-isocyano-8-(2-methylpropylsulfanyl)-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyrazine |
| SMILES | [C-]#[N+]c1cnc(SCC(C)C)c2nnc(C(F)(F)F)n12 |
| InChI | InChI=1S/C11H10F3N5S/c1-6(2)5-20-9-8-17-18-10(11(12,13)14)19(8)7(15-3)4-16-9/h4,6H,5H2,1-2H3 |
| InChIKey | BBIHCNJDNVKHEZ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 47.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|