C15H14F4N4OS — CID 23380677
5-[[8-fluoro-1-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl]sulfanyl]pentan-1-ol (PubChem CID 23380677) has the molecular formula C15H14F4N4OS and a molecular weight of 374.36 g/mol. Its IUPAC name is 5-[[8-fluoro-1-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl]sulfanyl]pentan-1-ol.
| Compound Name | 5-[[8-fluoro-1-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl]sulfanyl]pentan-1-ol |
|---|---|
| PubChem CID | 23380677 |
| Molecular Formula | C15H14F4N4OS |
| Molecular Weight | 374.36 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | 5-[[8-fluoro-1-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl]sulfanyl]pentan-1-ol |
| SMILES | OCCCCCSc1nc2ccc(F)cc2n2c(C(F)(F)F)nnc12 |
| InChI | InChI=1S/C15H14F4N4OS/c16-9-4-5-10-11(8-9)23-12(21-22-14(23)15(17,18)19)13(20-10)25-7-3-1-2-6-24/h4-5,8,24H,1-3,6-7H2 |
| InChIKey | MEUKTBRTXFQVHQ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 63.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.36 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|