C27H33ClN4O3 — CID 23381053
1-[4-[5-[[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]methyl]oxolan-2-yl]but-3-ynyl]-1-hydroxyurea (PubChem CID 23381053) has the molecular formula C27H33ClN4O3 and a molecular weight of 497.04 g/mol. Its IUPAC name is 1-[4-[5-[[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]methyl]oxolan-2-yl]but-3-ynyl]-1-hydroxyurea.
| Compound Name | 1-[4-[5-[[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]methyl]oxolan-2-yl]but-3-ynyl]-1-hydroxyurea |
|---|---|
| PubChem CID | 23381053 |
| Molecular Formula | C27H33ClN4O3 |
| Molecular Weight | 497.04 g/mol |
| Exact Mass | 496.22 |
| IUPAC Name | 1-[4-[5-[[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]methyl]oxolan-2-yl]but-3-ynyl]-1-hydroxyurea |
| SMILES | NC(=O)N(O)CCC#CC1CCC(CN2CCN(C(c3ccccc3)c3ccc(Cl)cc3)CC2)O1 |
| InChI | InChI=1S/C27H33ClN4O3/c28-23-11-9-22(10-12-23)26(21-6-2-1-3-7-21)31-18-16-30(17-19-31)20-25-14-13-24(35-25)8-4-5-15-32(34)27(29)33/h1-3,6-7,9-12,24-26,34H,5,13-20H2,(H2,29,33) |
| InChIKey | ZBUWQTCXTJMDCD-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.04 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|