C26H21FN6O2 — CID 23381211
N'-[1-[(2-fluorophenyl)methyl]-3-(5-formylfuran-2-yl)-6-phenylpyrazolo[3,4-d]pyrimidin-4-yl]-N,N-dimethylmethanimidamide (PubChem CID 23381211) has the molecular formula C26H21FN6O2 and a molecular weight of 468.49 g/mol. Its IUPAC name is N'-[1-[(2-fluorophenyl)methyl]-3-(5-formylfuran-2-yl)-6-phenylpyrazolo[3,4-d]pyrimidin-4-yl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[1-[(2-fluorophenyl)methyl]-3-(5-formylfuran-2-yl)-6-phenylpyrazolo[3,4-d]pyrimidin-4-yl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 23381211 |
| Molecular Formula | C26H21FN6O2 |
| Molecular Weight | 468.49 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | N'-[1-[(2-fluorophenyl)methyl]-3-(5-formylfuran-2-yl)-6-phenylpyrazolo[3,4-d]pyrimidin-4-yl]-N,N-dimethylmethanimidamide |
| SMILES | CN(C)/C=N/c1nc(-c2ccccc2)nc2c1c(-c1ccc(C=O)o1)nn2Cc1ccccc1F |
| InChI | InChI=1S/C26H21FN6O2/c1-32(2)16-28-25-22-23(21-13-12-19(15-34)35-21)31-33(14-18-10-6-7-11-20(18)27)26(22)30-24(29-25)17-8-4-3-5-9-17/h3-13,15-16H,14H2,1-2H3/b28-16+ |
| InChIKey | UELAZFZMQJFQTM-LQKURTRISA-N |
| XLogP | 4.97 |
| TPSA | 89.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.49 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|