C26H31F3N6O4 — CID 23382079
tert-butyl N-[[(2S,3S)-2-hydroxy-4-phenyl-3-[(2,2,2-trifluoroacetyl)amino]butyl]-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]amino]carbamate (PubChem CID 23382079) has the molecular formula C26H31F3N6O4 and a molecular weight of 548.57 g/mol. Its IUPAC name is tert-butyl N-[[(2S,3S)-2-hydroxy-4-phenyl-3-[(2,2,2-trifluoroacetyl)amino]butyl]-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]amino]carbamate.
| Compound Name | tert-butyl N-[[(2S,3S)-2-hydroxy-4-phenyl-3-[(2,2,2-trifluoroacetyl)amino]butyl]-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]amino]carbamate |
|---|---|
| PubChem CID | 23382079 |
| Molecular Formula | C26H31F3N6O4 |
| Molecular Weight | 548.57 g/mol |
| Exact Mass | 548.24 |
| IUPAC Name | tert-butyl N-[[(2S,3S)-2-hydroxy-4-phenyl-3-[(2,2,2-trifluoroacetyl)amino]butyl]-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]amino]carbamate |
| SMILES | CC(C)(C)OC(=O)NN(Cc1ccc(-n2cncn2)cc1)C[C@H](O)[C@H](Cc1ccccc1)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C26H31F3N6O4/c1-25(2,3)39-24(38)33-34(14-19-9-11-20(12-10-19)35-17-30-16-31-35)15-22(36)21(32-23(37)26(27,28)29)13-18-7-5-4-6-8-18/h4-12,16-17,21-22,36H,13-15H2,1-3H3,(H,32,37)(H,33,38)/t21-,22-/m0/s1 |
| InChIKey | RWTCXSPJGWVJQR-VXKWHMMOSA-N |
| XLogP | 3.16 |
| TPSA | 121.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.57 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|