C11H21N5O3S — CID 23382109
(2S)-2-amino-3-(1H-imidazol-5-yl)propanoic acid;(2S)-2-amino-4-methylsulfanylbutanamide (PubChem CID 23382109) has the molecular formula C11H21N5O3S and a molecular weight of 303.39 g/mol. Its IUPAC name is (2S)-2-amino-3-(1H-imidazol-5-yl)propanoic acid;(2S)-2-amino-4-methylsulfanylbutanamide.
| Compound Name | (2S)-2-amino-3-(1H-imidazol-5-yl)propanoic acid;(2S)-2-amino-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 23382109 |
| Molecular Formula | C11H21N5O3S |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | (2S)-2-amino-3-(1H-imidazol-5-yl)propanoic acid;(2S)-2-amino-4-methylsulfanylbutanamide |
| SMILES | CSCC[C@H](N)C(N)=O.N[C@@H](Cc1cnc[nH]1)C(=O)O |
| InChI | InChI=1S/C6H9N3O2.C5H12N2OS/c7-5(6(10)11)1-4-2-8-3-9-4;1-9-3-2-4(6)5(7)8/h2-3,5H,1,7H2,(H,8,9)(H,10,11);4H,2-3,6H2,1H3,(H2,7,8)/t5-;4-/m00/s1 |
| InChIKey | LNJVYWPUCPOYTR-VDQHJUMDSA-N |
| XLogP | -1.08 |
| TPSA | 161.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |