About 7-amino-1H-inden-4-ol
7-amino-1H-inden-4-ol (PubChem CID 23382234) has the molecular formula C9H9NO
and a molecular weight of 147.18 g/mol. Its IUPAC name is 7-amino-1H-inden-4-ol.
Molecular Properties
| Compound Name | 7-amino-1H-inden-4-ol |
| PubChem CID | 23382234 |
| Molecular Formula | C9H9NO |
| Molecular Weight | 147.18 g/mol |
| Exact Mass | 147.07 |
| IUPAC Name | 7-amino-1H-inden-4-ol |
| SMILES | Nc1ccc(O)c2c1CC=C2 |
| InChI | InChI=1S/C9H9NO/c10-8-4-5-9(11)7-3-1-2-6(7)8/h1,3-5,11H,2,10H2 |
| InChIKey | QWWYCXLJUJQHHY-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.18 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 7-amino-1H-inden-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-amino-1H-inden-4-ol?
The IUPAC name of 7-amino-1H-inden-4-ol (CID 23382234) is 7-amino-1H-inden-4-ol.
What is the SMILES notation for 7-amino-1H-inden-4-ol?
The canonical SMILES for 7-amino-1H-inden-4-ol is Nc1ccc(O)c2c1CC=C2.
What is the InChIKey of 7-amino-1H-inden-4-ol?
The InChIKey is QWWYCXLJUJQHHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO/c10-8-4-5-9(11)7-3-1-2-6(7)8/h1,3-5,11H,2,10H2.
What are the key properties of 7-amino-1H-inden-4-ol?
7-amino-1H-inden-4-ol has a molecular weight of 147.18 g/mol, XLogP of 1.54, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-amino-1H-inden-4-ol is sourced from PubChem (CID 23382234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).