About 3-oxatricyclo[3.2.1.02,4]octan-6-ylmethanol
3-oxatricyclo[3.2.1.02,4]octan-6-ylmethanol (PubChem CID 23382653) has the molecular formula C8H12O2
and a molecular weight of 140.18 g/mol. Its IUPAC name is 3-oxatricyclo[3.2.1.02,4]octan-6-ylmethanol.
Molecular Properties
| Compound Name | 3-oxatricyclo[3.2.1.02,4]octan-6-ylmethanol |
| PubChem CID | 23382653 |
| Molecular Formula | C8H12O2 |
| Molecular Weight | 140.18 g/mol |
| Exact Mass | 140.08 |
| IUPAC Name | 3-oxatricyclo[3.2.1.02,4]octan-6-ylmethanol |
| SMILES | OCC1CC2CC1C1OC21 |
| InChI | InChI=1S/C8H12O2/c9-3-5-1-4-2-6(5)8-7(4)10-8/h4-9H,1-3H2 |
| InChIKey | UMYCCRNFNCCUFN-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.18 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 3-oxatricyclo[3.2.1.02,4]octan-6-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-oxatricyclo[3.2.1.02,4]octan-6-ylmethanol?
The IUPAC name of 3-oxatricyclo[3.2.1.02,4]octan-6-ylmethanol (CID 23382653) is 3-oxatricyclo[3.2.1.02,4]octan-6-ylmethanol.
What is the SMILES notation for 3-oxatricyclo[3.2.1.02,4]octan-6-ylmethanol?
The canonical SMILES for 3-oxatricyclo[3.2.1.02,4]octan-6-ylmethanol is OCC1CC2CC1C1OC21.
What is the InChIKey of 3-oxatricyclo[3.2.1.02,4]octan-6-ylmethanol?
The InChIKey is UMYCCRNFNCCUFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O2/c9-3-5-1-4-2-6(5)8-7(4)10-8/h4-9H,1-3H2.
What are the key properties of 3-oxatricyclo[3.2.1.02,4]octan-6-ylmethanol?
3-oxatricyclo[3.2.1.02,4]octan-6-ylmethanol has a molecular weight of 140.18 g/mol, XLogP of 0.40, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxatricyclo[3.2.1.02,4]octan-6-ylmethanol is sourced from PubChem (CID 23382653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).