C40H52ClN5O6S — CID 23383004
N-[2-chloro-5-(methanesulfonamido)phenyl]-3-(1,3-dioctyl-2-oxo-5-phenylimidazol-4-yl)-3-oxo-2-pyridin-2-yloxypropanamide (PubChem CID 23383004) has the molecular formula C40H52ClN5O6S and a molecular weight of 766.41 g/mol. Its IUPAC name is N-[2-chloro-5-(methanesulfonamido)phenyl]-3-(1,3-dioctyl-2-oxo-5-phenylimidazol-4-yl)-3-oxo-2-pyridin-2-yloxypropanamide.
| Compound Name | N-[2-chloro-5-(methanesulfonamido)phenyl]-3-(1,3-dioctyl-2-oxo-5-phenylimidazol-4-yl)-3-oxo-2-pyridin-2-yloxypropanamide |
|---|---|
| PubChem CID | 23383004 |
| Molecular Formula | C40H52ClN5O6S |
| Molecular Weight | 766.41 g/mol |
| Exact Mass | 765.33 |
| IUPAC Name | N-[2-chloro-5-(methanesulfonamido)phenyl]-3-(1,3-dioctyl-2-oxo-5-phenylimidazol-4-yl)-3-oxo-2-pyridin-2-yloxypropanamide |
| SMILES | CCCCCCCCn1c(C(=O)C(Oc2ccccn2)C(=O)Nc2cc(NS(C)(=O)=O)ccc2Cl)c(-c2ccccc2)n(CCCCCCCC)c1=O |
| InChI | InChI=1S/C40H52ClN5O6S/c1-4-6-8-10-12-19-27-45-35(30-21-15-14-16-22-30)36(46(40(45)49)28-20-13-11-9-7-5-2)37(47)38(52-34-23-17-18-26-42-34)39(48)43-33-29-31(24-25-32(33)41)44-53(3,50)51/h14-18,21-26,29,38,44H,4-13,19-20,27-28H2,1-3H3,(H,43,48) |
| InChIKey | OUKBMWUYGIKBHN-UHFFFAOYSA-N |
| XLogP | 8.73 |
| TPSA | 141.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.41 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|