About 4,5-dimethoxy-2,6-dimethyloxan-3-ol
4,5-dimethoxy-2,6-dimethyloxan-3-ol (PubChem CID 23383139) has the molecular formula C9H18O4
and a molecular weight of 190.24 g/mol. Its IUPAC name is 4,5-dimethoxy-2,6-dimethyloxan-3-ol.
Molecular Properties
| Compound Name | 4,5-dimethoxy-2,6-dimethyloxan-3-ol |
| PubChem CID | 23383139 |
| Molecular Formula | C9H18O4 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | 4,5-dimethoxy-2,6-dimethyloxan-3-ol |
| SMILES | COC1C(C)OC(C)C(O)C1OC |
| InChI | InChI=1S/C9H18O4/c1-5-7(10)9(12-4)8(11-3)6(2)13-5/h5-10H,1-4H3 |
| InChIKey | BBGFTQCERXPALH-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4,5-dimethoxy-2,6-dimethyloxan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dimethoxy-2,6-dimethyloxan-3-ol?
The IUPAC name of 4,5-dimethoxy-2,6-dimethyloxan-3-ol (CID 23383139) is 4,5-dimethoxy-2,6-dimethyloxan-3-ol.
What is the SMILES notation for 4,5-dimethoxy-2,6-dimethyloxan-3-ol?
The canonical SMILES for 4,5-dimethoxy-2,6-dimethyloxan-3-ol is COC1C(C)OC(C)C(O)C1OC.
What is the InChIKey of 4,5-dimethoxy-2,6-dimethyloxan-3-ol?
The InChIKey is BBGFTQCERXPALH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O4/c1-5-7(10)9(12-4)8(11-3)6(2)13-5/h5-10H,1-4H3.
What are the key properties of 4,5-dimethoxy-2,6-dimethyloxan-3-ol?
4,5-dimethoxy-2,6-dimethyloxan-3-ol has a molecular weight of 190.24 g/mol, XLogP of 0.18, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethoxy-2,6-dimethyloxan-3-ol is sourced from PubChem (CID 23383139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).