About 2-butyl-1,6-naphthyridine
2-butyl-1,6-naphthyridine (PubChem CID 23383449) has the molecular formula C12H14N2
and a molecular weight of 186.26 g/mol. Its IUPAC name is 2-butyl-1,6-naphthyridine.
Molecular Properties
| Compound Name | 2-butyl-1,6-naphthyridine |
| PubChem CID | 23383449 |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 2-butyl-1,6-naphthyridine |
| SMILES | CCCCc1ccc2cnccc2n1 |
| InChI | InChI=1S/C12H14N2/c1-2-3-4-11-6-5-10-9-13-8-7-12(10)14-11/h5-9H,2-4H2,1H3 |
| InChIKey | VGZPIKTYPFDDGA-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-butyl-1,6-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-1,6-naphthyridine?
The IUPAC name of 2-butyl-1,6-naphthyridine (CID 23383449) is 2-butyl-1,6-naphthyridine.
What is the SMILES notation for 2-butyl-1,6-naphthyridine?
The canonical SMILES for 2-butyl-1,6-naphthyridine is CCCCc1ccc2cnccc2n1.
What is the InChIKey of 2-butyl-1,6-naphthyridine?
The InChIKey is VGZPIKTYPFDDGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2/c1-2-3-4-11-6-5-10-9-13-8-7-12(10)14-11/h5-9H,2-4H2,1H3.
What are the key properties of 2-butyl-1,6-naphthyridine?
2-butyl-1,6-naphthyridine has a molecular weight of 186.26 g/mol, XLogP of 2.97, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-1,6-naphthyridine is sourced from PubChem (CID 23383449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).