About [4-(aminomethyl)-3,5-dimethylphenyl]methanol
[4-(aminomethyl)-3,5-dimethylphenyl]methanol (PubChem CID 23383595) has the molecular formula C10H15NO
and a molecular weight of 165.24 g/mol. Its IUPAC name is [4-(aminomethyl)-3,5-dimethylphenyl]methanol.
Molecular Properties
| Compound Name | [4-(aminomethyl)-3,5-dimethylphenyl]methanol |
| PubChem CID | 23383595 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | [4-(aminomethyl)-3,5-dimethylphenyl]methanol |
| SMILES | Cc1cc(CO)cc(C)c1CN |
| InChI | InChI=1S/C10H15NO/c1-7-3-9(6-12)4-8(2)10(7)5-11/h3-4,12H,5-6,11H2,1-2H3 |
| InChIKey | GCAPTLCHEBIWGU-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [4-(aminomethyl)-3,5-dimethylphenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(aminomethyl)-3,5-dimethylphenyl]methanol?
The IUPAC name of [4-(aminomethyl)-3,5-dimethylphenyl]methanol (CID 23383595) is [4-(aminomethyl)-3,5-dimethylphenyl]methanol.
What is the SMILES notation for [4-(aminomethyl)-3,5-dimethylphenyl]methanol?
The canonical SMILES for [4-(aminomethyl)-3,5-dimethylphenyl]methanol is Cc1cc(CO)cc(C)c1CN.
What is the InChIKey of [4-(aminomethyl)-3,5-dimethylphenyl]methanol?
The InChIKey is GCAPTLCHEBIWGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO/c1-7-3-9(6-12)4-8(2)10(7)5-11/h3-4,12H,5-6,11H2,1-2H3.
What are the key properties of [4-(aminomethyl)-3,5-dimethylphenyl]methanol?
[4-(aminomethyl)-3,5-dimethylphenyl]methanol has a molecular weight of 165.24 g/mol, XLogP of 1.25, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(aminomethyl)-3,5-dimethylphenyl]methanol is sourced from PubChem (CID 23383595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).