About (4-tert-butylphenyl)-(2,6-dimethylmorpholin-4-yl)methanimine
(4-tert-butylphenyl)-(2,6-dimethylmorpholin-4-yl)methanimine (PubChem CID 23384226) has the molecular formula C17H26N2O
and a molecular weight of 274.41 g/mol. Its IUPAC name is (4-tert-butylphenyl)-(2,6-dimethylmorpholin-4-yl)methanimine.
Molecular Properties
| Compound Name | (4-tert-butylphenyl)-(2,6-dimethylmorpholin-4-yl)methanimine |
| PubChem CID | 23384226 |
| Molecular Formula | C17H26N2O |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | (4-tert-butylphenyl)-(2,6-dimethylmorpholin-4-yl)methanimine |
| SMILES | [H]/N=C(\c1ccc(C(C)(C)C)cc1)N1CC(C)OC(C)C1 |
| InChI | InChI=1S/C17H26N2O/c1-12-10-19(11-13(2)20-12)16(18)14-6-8-15(9-7-14)17(3,4)5/h6-9,12-13,18H,10-11H2,1-5H3/b18-16+ |
| InChIKey | RAUFRKLBEAFVRH-FBMGVBCBSA-N |
| XLogP | 3.42 |
| TPSA | 36.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (4-tert-butylphenyl)-(2,6-dimethylmorpholin-4-yl)methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-tert-butylphenyl)-(2,6-dimethylmorpholin-4-yl)methanimine?
The IUPAC name of (4-tert-butylphenyl)-(2,6-dimethylmorpholin-4-yl)methanimine (CID 23384226) is (4-tert-butylphenyl)-(2,6-dimethylmorpholin-4-yl)methanimine.
What is the SMILES notation for (4-tert-butylphenyl)-(2,6-dimethylmorpholin-4-yl)methanimine?
The canonical SMILES for (4-tert-butylphenyl)-(2,6-dimethylmorpholin-4-yl)methanimine is [H]/N=C(\c1ccc(C(C)(C)C)cc1)N1CC(C)OC(C)C1.
What is the InChIKey of (4-tert-butylphenyl)-(2,6-dimethylmorpholin-4-yl)methanimine?
The InChIKey is RAUFRKLBEAFVRH-FBMGVBCBSA-N. The full InChI is InChI=1S/C17H26N2O/c1-12-10-19(11-13(2)20-12)16(18)14-6-8-15(9-7-14)17(3,4)5/h6-9,12-13,18H,10-11H2,1-5H3/b18-16+.
What are the key properties of (4-tert-butylphenyl)-(2,6-dimethylmorpholin-4-yl)methanimine?
(4-tert-butylphenyl)-(2,6-dimethylmorpholin-4-yl)methanimine has a molecular weight of 274.41 g/mol, XLogP of 3.42, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-tert-butylphenyl)-(2,6-dimethylmorpholin-4-yl)methanimine is sourced from PubChem (CID 23384226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).