C21H29N3O5 — CID 23384248
ethyl 2-[1-[[3-[4-(C-ethoxycarbonimidoyl)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]pyrrolidin-3-yl]oxyacetate (PubChem CID 23384248) has the molecular formula C21H29N3O5 and a molecular weight of 403.48 g/mol. Its IUPAC name is ethyl 2-[1-[[3-[4-(C-ethoxycarbonimidoyl)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]pyrrolidin-3-yl]oxyacetate.
| Compound Name | ethyl 2-[1-[[3-[4-(C-ethoxycarbonimidoyl)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]pyrrolidin-3-yl]oxyacetate |
|---|---|
| PubChem CID | 23384248 |
| Molecular Formula | C21H29N3O5 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | ethyl 2-[1-[[3-[4-(C-ethoxycarbonimidoyl)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]pyrrolidin-3-yl]oxyacetate |
| SMILES | [H]/N=C(\OCC)c1ccc(C2=NOC(CN3CCC(OCC(=O)OCC)C3)C2)cc1 |
| InChI | InChI=1S/C21H29N3O5/c1-3-26-20(25)14-28-17-9-10-24(12-17)13-18-11-19(23-29-18)15-5-7-16(8-6-15)21(22)27-4-2/h5-8,17-18,22H,3-4,9-14H2,1-2H3/b22-21- |
| InChIKey | JLUPBLVIXJJSGQ-DQRAZIAOSA-N |
| XLogP | 2.20 |
| TPSA | 93.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|