C15H27N3O3 — CID 23384564
(2R,4S,5R)-5-[2-(1-acetamidobutylamino)ethyl]-4-ethenylpyrrolidine-2-carboxylic acid (PubChem CID 23384564) has the molecular formula C15H27N3O3 and a molecular weight of 297.40 g/mol. Its IUPAC name is (2R,4S,5R)-5-[2-(1-acetamidobutylamino)ethyl]-4-ethenylpyrrolidine-2-carboxylic acid.
| Compound Name | (2R,4S,5R)-5-[2-(1-acetamidobutylamino)ethyl]-4-ethenylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 23384564 |
| Molecular Formula | C15H27N3O3 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | (2R,4S,5R)-5-[2-(1-acetamidobutylamino)ethyl]-4-ethenylpyrrolidine-2-carboxylic acid |
| SMILES | C=C[C@@H]1C[C@H](C(=O)O)N[C@@H]1CCNC(CCC)NC(C)=O |
| InChI | InChI=1S/C15H27N3O3/c1-4-6-14(17-10(3)19)16-8-7-12-11(5-2)9-13(18-12)15(20)21/h5,11-14,16,18H,2,4,6-9H2,1,3H3,(H,17,19)(H,20,21)/t11-,12-,13-,14?/m1/s1 |
| InChIKey | BUBQXBROLFMVMG-ZHZAVPAVSA-N |
| XLogP | 0.85 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|