C8H7F9 — CID 23384626
1,1,1-trifluoro-4-methyl-2,3-bis(trifluoromethyl)pent-2-ene (PubChem CID 23384626) has the molecular formula C8H7F9 and a molecular weight of 274.13 g/mol. Its IUPAC name is 1,1,1-trifluoro-4-methyl-2,3-bis(trifluoromethyl)pent-2-ene.
| Compound Name | 1,1,1-trifluoro-4-methyl-2,3-bis(trifluoromethyl)pent-2-ene |
|---|---|
| PubChem CID | 23384626 |
| Molecular Formula | C8H7F9 |
| Molecular Weight | 274.13 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | 1,1,1-trifluoro-4-methyl-2,3-bis(trifluoromethyl)pent-2-ene |
| SMILES | CC(C)C(=C(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H7F9/c1-3(2)4(6(9,10)11)5(7(12,13)14)8(15,16)17/h3H,1-2H3 |
| InChIKey | UKTLCWBORWUBGQ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.13 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|