About (Z)-1,1,1-trifluoro-4-methyl-3-(trifluoromethyl)pent-2-ene
(Z)-1,1,1-trifluoro-4-methyl-3-(trifluoromethyl)pent-2-ene (PubChem CID 23384627) has the molecular formula C7H8F6
and a molecular weight of 206.13 g/mol. Its IUPAC name is (Z)-1,1,1-trifluoro-4-methyl-3-(trifluoromethyl)pent-2-ene.
Molecular Properties
| Compound Name | (Z)-1,1,1-trifluoro-4-methyl-3-(trifluoromethyl)pent-2-ene |
| PubChem CID | 23384627 |
| Molecular Formula | C7H8F6 |
| Molecular Weight | 206.13 g/mol |
| Exact Mass | 206.05 |
| IUPAC Name | (Z)-1,1,1-trifluoro-4-methyl-3-(trifluoromethyl)pent-2-ene |
| SMILES | CC(C)/C(=C/C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H8F6/c1-4(2)5(7(11,12)13)3-6(8,9)10/h3-4H,1-2H3/b5-3- |
| InChIKey | FAOLLCVMZLVEFG-HYXAFXHYSA-N |
| XLogP | 3.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.13 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-1,1,1-trifluoro-4-methyl-3-(trifluoromethyl)pent-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1,1,1-trifluoro-4-methyl-3-(trifluoromethyl)pent-2-ene?
The IUPAC name of (Z)-1,1,1-trifluoro-4-methyl-3-(trifluoromethyl)pent-2-ene (CID 23384627) is (Z)-1,1,1-trifluoro-4-methyl-3-(trifluoromethyl)pent-2-ene.
What is the SMILES notation for (Z)-1,1,1-trifluoro-4-methyl-3-(trifluoromethyl)pent-2-ene?
The canonical SMILES for (Z)-1,1,1-trifluoro-4-methyl-3-(trifluoromethyl)pent-2-ene is CC(C)/C(=C/C(F)(F)F)C(F)(F)F.
What is the InChIKey of (Z)-1,1,1-trifluoro-4-methyl-3-(trifluoromethyl)pent-2-ene?
The InChIKey is FAOLLCVMZLVEFG-HYXAFXHYSA-N. The full InChI is InChI=1S/C7H8F6/c1-4(2)5(7(11,12)13)3-6(8,9)10/h3-4H,1-2H3/b5-3-.
What are the key properties of (Z)-1,1,1-trifluoro-4-methyl-3-(trifluoromethyl)pent-2-ene?
(Z)-1,1,1-trifluoro-4-methyl-3-(trifluoromethyl)pent-2-ene has a molecular weight of 206.13 g/mol, XLogP of 3.69, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1,1,1-trifluoro-4-methyl-3-(trifluoromethyl)pent-2-ene is sourced from PubChem (CID 23384627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).