C18H20N3O6+ — CID 2338463
(1S,5R,9R)-3-benzyl-1,5-dinitro-9-(2-oxopropyl)-3-azoniabicyclo[3.3.1]non-7-en-6-one (PubChem CID 2338463) has the molecular formula C18H20N3O6+ and a molecular weight of 374.37 g/mol. Its IUPAC name is (1S,5R,9R)-3-benzyl-1,5-dinitro-9-(2-oxopropyl)-3-azoniabicyclo[3.3.1]non-7-en-6-one.
| Compound Name | (1S,5R,9R)-3-benzyl-1,5-dinitro-9-(2-oxopropyl)-3-azoniabicyclo[3.3.1]non-7-en-6-one |
|---|---|
| PubChem CID | 2338463 |
| Molecular Formula | C18H20N3O6+ |
| Molecular Weight | 374.37 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | (1S,5R,9R)-3-benzyl-1,5-dinitro-9-(2-oxopropyl)-3-azoniabicyclo[3.3.1]non-7-en-6-one |
| SMILES | CC(=O)C[C@@H]1[C@@]2([N+](=O)[O-])C=CC(=O)[C@]1([N+](=O)[O-])C[NH+](Cc1ccccc1)C2 |
| InChI | InChI=1S/C18H19N3O6/c1-13(22)9-15-17(20(24)25)8-7-16(23)18(15,21(26)27)12-19(11-17)10-14-5-3-2-4-6-14/h2-8,15H,9-12H2,1H3/p+1/t15-,17-,18+/m1/s1 |
| InChIKey | XRTFBRIDWBEVBX-NXHRZFHOSA-O |
| XLogP | -0.15 |
| TPSA | 124.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.37 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|