About 2,2-dibromoadamantane
2,2-dibromoadamantane (PubChem CID 2338476) has the molecular formula C10H14Br2
and a molecular weight of 294.03 g/mol. Its IUPAC name is 2,2-dibromoadamantane.
Molecular Properties
| Compound Name | 2,2-dibromoadamantane |
| PubChem CID | 2338476 |
| Molecular Formula | C10H14Br2 |
| Molecular Weight | 294.03 g/mol |
| Exact Mass | 291.95 |
| IUPAC Name | 2,2-dibromoadamantane |
| SMILES | BrC1(Br)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C10H14Br2/c11-10(12)8-2-6-1-7(4-8)5-9(10)3-6/h6-9H,1-5H2 |
| InChIKey | XKDNOVQSEAPAKG-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.03 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dibromoadamantane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dibromoadamantane?
The IUPAC name of 2,2-dibromoadamantane (CID 2338476) is 2,2-dibromoadamantane.
What is the SMILES notation for 2,2-dibromoadamantane?
The canonical SMILES for 2,2-dibromoadamantane is BrC1(Br)C2CC3CC(C2)CC1C3.
What is the InChIKey of 2,2-dibromoadamantane?
The InChIKey is XKDNOVQSEAPAKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14Br2/c11-10(12)8-2-6-1-7(4-8)5-9(10)3-6/h6-9H,1-5H2.
What are the key properties of 2,2-dibromoadamantane?
2,2-dibromoadamantane has a molecular weight of 294.03 g/mol, XLogP of 3.93, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dibromoadamantane is sourced from PubChem (CID 2338476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).