About actinium;1-[3-ethenyl-4-(1-propan-2-ylsulfanylpropan-2-yl)cyclopentyl]ethanone
actinium;1-[3-ethenyl-4-(1-propan-2-ylsulfanylpropan-2-yl)cyclopentyl]ethanone (PubChem CID 23384778) has the molecular formula C15H25AcOS-
and a molecular weight of 480.43 g/mol. Its IUPAC name is actinium;1-[3-ethenyl-4-(1-propan-2-ylsulfanylpropan-2-yl)cyclopentyl]ethanone.
Molecular Properties
| Compound Name | actinium;1-[3-ethenyl-4-(1-propan-2-ylsulfanylpropan-2-yl)cyclopentyl]ethanone |
| PubChem CID | 23384778 |
| Molecular Formula | C15H25AcOS- |
| Molecular Weight | 480.43 g/mol |
| Exact Mass | 480.19 |
| IUPAC Name | actinium;1-[3-ethenyl-4-(1-propan-2-ylsulfanylpropan-2-yl)cyclopentyl]ethanone |
| SMILES | C=CC1CC(C(C)=O)CC1C([CH2-])CSC(C)C.[Ac] |
| InChI | InChI=1S/C15H25OS.Ac/c1-6-13-7-14(12(5)16)8-15(13)11(4)9-17-10(2)3;/h6,10-11,13-15H,1,4,7-9H2,2-3,5H3;/q-1; |
| InChIKey | DJQOJMBBOOZFGP-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 480.43 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze actinium;1-[3-ethenyl-4-(1-propan-2-ylsulfanylpropan-2-yl)cyclopentyl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of actinium;1-[3-ethenyl-4-(1-propan-2-ylsulfanylpropan-2-yl)cyclopentyl]ethanone?
The IUPAC name of actinium;1-[3-ethenyl-4-(1-propan-2-ylsulfanylpropan-2-yl)cyclopentyl]ethanone (CID 23384778) is actinium;1-[3-ethenyl-4-(1-propan-2-ylsulfanylpropan-2-yl)cyclopentyl]ethanone.
What is the SMILES notation for actinium;1-[3-ethenyl-4-(1-propan-2-ylsulfanylpropan-2-yl)cyclopentyl]ethanone?
The canonical SMILES for actinium;1-[3-ethenyl-4-(1-propan-2-ylsulfanylpropan-2-yl)cyclopentyl]ethanone is C=CC1CC(C(C)=O)CC1C([CH2-])CSC(C)C.[Ac].
What is the InChIKey of actinium;1-[3-ethenyl-4-(1-propan-2-ylsulfanylpropan-2-yl)cyclopentyl]ethanone?
The InChIKey is DJQOJMBBOOZFGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25OS.Ac/c1-6-13-7-14(12(5)16)8-15(13)11(4)9-17-10(2)3;/h6,10-11,13-15H,1,4,7-9H2,2-3,5H3;/q-1;.
What are the key properties of actinium;1-[3-ethenyl-4-(1-propan-2-ylsulfanylpropan-2-yl)cyclopentyl]ethanone?
actinium;1-[3-ethenyl-4-(1-propan-2-ylsulfanylpropan-2-yl)cyclopentyl]ethanone has a molecular weight of 480.43 g/mol, XLogP of 4.00, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for actinium;1-[3-ethenyl-4-(1-propan-2-ylsulfanylpropan-2-yl)cyclopentyl]ethanone is sourced from PubChem (CID 23384778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).