About (Z)-2-chloro-1,1,1,3-tetrafluoro-4-methylpent-2-ene
(Z)-2-chloro-1,1,1,3-tetrafluoro-4-methylpent-2-ene (PubChem CID 23384789) has the molecular formula C6H7ClF4
and a molecular weight of 190.57 g/mol. Its IUPAC name is (Z)-2-chloro-1,1,1,3-tetrafluoro-4-methylpent-2-ene.
Analyze (Z)-2-chloro-1,1,1,3-tetrafluoro-4-methylpent-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-chloro-1,1,1,3-tetrafluoro-4-methylpent-2-ene?
The IUPAC name of (Z)-2-chloro-1,1,1,3-tetrafluoro-4-methylpent-2-ene (CID 23384789) is (Z)-2-chloro-1,1,1,3-tetrafluoro-4-methylpent-2-ene.
What is the SMILES notation for (Z)-2-chloro-1,1,1,3-tetrafluoro-4-methylpent-2-ene?
The canonical SMILES for (Z)-2-chloro-1,1,1,3-tetrafluoro-4-methylpent-2-ene is CC(C)/C(F)=C(/Cl)C(F)(F)F.
What is the InChIKey of (Z)-2-chloro-1,1,1,3-tetrafluoro-4-methylpent-2-ene?
The InChIKey is WVXTZQDBCXSLOW-PLNGDYQASA-N. The full InChI is InChI=1S/C6H7ClF4/c1-3(2)4(8)5(7)6(9,10)11/h3H,1-2H3/b5-4-.
What are the key properties of (Z)-2-chloro-1,1,1,3-tetrafluoro-4-methylpent-2-ene?
(Z)-2-chloro-1,1,1,3-tetrafluoro-4-methylpent-2-ene has a molecular weight of 190.57 g/mol, XLogP of 3.62, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-chloro-1,1,1,3-tetrafluoro-4-methylpent-2-ene is sourced from PubChem (CID 23384789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).