About (Z)-2-chloro-1,1,1,3-tetrafluoro-4-methylpent-2-ene
(Z)-2-chloro-1,1,1,3-tetrafluoro-4-methylpent-2-ene (PubChem CID 23384789) has the molecular formula C6H7ClF4
and a molecular weight of 190.57 g/mol. Its IUPAC name is (Z)-2-chloro-1,1,1,3-tetrafluoro-4-methylpent-2-ene.
Molecular Properties
| Compound Name | (Z)-2-chloro-1,1,1,3-tetrafluoro-4-methylpent-2-ene |
| PubChem CID | 23384789 |
| Molecular Formula | C6H7ClF4 |
| Molecular Weight | 190.57 g/mol |
| Exact Mass | 190.02 |
| IUPAC Name | (Z)-2-chloro-1,1,1,3-tetrafluoro-4-methylpent-2-ene |
| SMILES | CC(C)/C(F)=C(/Cl)C(F)(F)F |
| InChI | InChI=1S/C6H7ClF4/c1-3(2)4(8)5(7)6(9,10)11/h3H,1-2H3/b5-4- |
| InChIKey | WVXTZQDBCXSLOW-PLNGDYQASA-N |
| XLogP | 3.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.57 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (Z)-2-chloro-1,1,1,3-tetrafluoro-4-methylpent-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-chloro-1,1,1,3-tetrafluoro-4-methylpent-2-ene?
The IUPAC name of (Z)-2-chloro-1,1,1,3-tetrafluoro-4-methylpent-2-ene (CID 23384789) is (Z)-2-chloro-1,1,1,3-tetrafluoro-4-methylpent-2-ene.
What is the SMILES notation for (Z)-2-chloro-1,1,1,3-tetrafluoro-4-methylpent-2-ene?
The canonical SMILES for (Z)-2-chloro-1,1,1,3-tetrafluoro-4-methylpent-2-ene is CC(C)/C(F)=C(/Cl)C(F)(F)F.
What is the InChIKey of (Z)-2-chloro-1,1,1,3-tetrafluoro-4-methylpent-2-ene?
The InChIKey is WVXTZQDBCXSLOW-PLNGDYQASA-N. The full InChI is InChI=1S/C6H7ClF4/c1-3(2)4(8)5(7)6(9,10)11/h3H,1-2H3/b5-4-.
What are the key properties of (Z)-2-chloro-1,1,1,3-tetrafluoro-4-methylpent-2-ene?
(Z)-2-chloro-1,1,1,3-tetrafluoro-4-methylpent-2-ene has a molecular weight of 190.57 g/mol, XLogP of 3.62, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-chloro-1,1,1,3-tetrafluoro-4-methylpent-2-ene is sourced from PubChem (CID 23384789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).