About 6-propan-2-yl-3,6-dihydro-2H-pyran
6-propan-2-yl-3,6-dihydro-2H-pyran (PubChem CID 23384838) has the molecular formula C8H14O
and a molecular weight of 126.20 g/mol. Its IUPAC name is 6-propan-2-yl-3,6-dihydro-2H-pyran.
Molecular Properties
| Compound Name | 6-propan-2-yl-3,6-dihydro-2H-pyran |
| PubChem CID | 23384838 |
| Molecular Formula | C8H14O |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.10 |
| IUPAC Name | 6-propan-2-yl-3,6-dihydro-2H-pyran |
| SMILES | CC(C)C1C=CCCO1 |
| InChI | InChI=1S/C8H14O/c1-7(2)8-5-3-4-6-9-8/h3,5,7-8H,4,6H2,1-2H3 |
| InChIKey | LHPITFCZZYSJDW-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-propan-2-yl-3,6-dihydro-2H-pyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-propan-2-yl-3,6-dihydro-2H-pyran?
The IUPAC name of 6-propan-2-yl-3,6-dihydro-2H-pyran (CID 23384838) is 6-propan-2-yl-3,6-dihydro-2H-pyran.
What is the SMILES notation for 6-propan-2-yl-3,6-dihydro-2H-pyran?
The canonical SMILES for 6-propan-2-yl-3,6-dihydro-2H-pyran is CC(C)C1C=CCCO1.
What is the InChIKey of 6-propan-2-yl-3,6-dihydro-2H-pyran?
The InChIKey is LHPITFCZZYSJDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O/c1-7(2)8-5-3-4-6-9-8/h3,5,7-8H,4,6H2,1-2H3.
What are the key properties of 6-propan-2-yl-3,6-dihydro-2H-pyran?
6-propan-2-yl-3,6-dihydro-2H-pyran has a molecular weight of 126.20 g/mol, XLogP of 1.99, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-propan-2-yl-3,6-dihydro-2H-pyran is sourced from PubChem (CID 23384838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).