About actinium;1-[3-(1,2-dihydroxyethyl)-4-(hydroxymethyl)cyclopentyl]ethanone
actinium;1-[3-(1,2-dihydroxyethyl)-4-(hydroxymethyl)cyclopentyl]ethanone (PubChem CID 23384988) has the molecular formula C10H18AcO4
and a molecular weight of 429.25 g/mol. Its IUPAC name is actinium;1-[3-(1,2-dihydroxyethyl)-4-(hydroxymethyl)cyclopentyl]ethanone.
Molecular Properties
| Compound Name | actinium;1-[3-(1,2-dihydroxyethyl)-4-(hydroxymethyl)cyclopentyl]ethanone |
| PubChem CID | 23384988 |
| Molecular Formula | C10H18AcO4 |
| Molecular Weight | 429.25 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | actinium;1-[3-(1,2-dihydroxyethyl)-4-(hydroxymethyl)cyclopentyl]ethanone |
| SMILES | CC(=O)C1CC(CO)C(C(O)CO)C1.[Ac] |
| InChI | InChI=1S/C10H18O4.Ac/c1-6(13)7-2-8(4-11)9(3-7)10(14)5-12;/h7-12,14H,2-5H2,1H3; |
| InChIKey | MSRGXSKWDXGPFT-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 429.25 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze actinium;1-[3-(1,2-dihydroxyethyl)-4-(hydroxymethyl)cyclopentyl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of actinium;1-[3-(1,2-dihydroxyethyl)-4-(hydroxymethyl)cyclopentyl]ethanone?
The IUPAC name of actinium;1-[3-(1,2-dihydroxyethyl)-4-(hydroxymethyl)cyclopentyl]ethanone (CID 23384988) is actinium;1-[3-(1,2-dihydroxyethyl)-4-(hydroxymethyl)cyclopentyl]ethanone.
What is the SMILES notation for actinium;1-[3-(1,2-dihydroxyethyl)-4-(hydroxymethyl)cyclopentyl]ethanone?
The canonical SMILES for actinium;1-[3-(1,2-dihydroxyethyl)-4-(hydroxymethyl)cyclopentyl]ethanone is CC(=O)C1CC(CO)C(C(O)CO)C1.[Ac].
What is the InChIKey of actinium;1-[3-(1,2-dihydroxyethyl)-4-(hydroxymethyl)cyclopentyl]ethanone?
The InChIKey is MSRGXSKWDXGPFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O4.Ac/c1-6(13)7-2-8(4-11)9(3-7)10(14)5-12;/h7-12,14H,2-5H2,1H3;.
What are the key properties of actinium;1-[3-(1,2-dihydroxyethyl)-4-(hydroxymethyl)cyclopentyl]ethanone?
actinium;1-[3-(1,2-dihydroxyethyl)-4-(hydroxymethyl)cyclopentyl]ethanone has a molecular weight of 429.25 g/mol, XLogP of -0.44, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for actinium;1-[3-(1,2-dihydroxyethyl)-4-(hydroxymethyl)cyclopentyl]ethanone is sourced from PubChem (CID 23384988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).