About phenyl-(5-pyridin-4-yl-1,3,4-oxadiazol-2-yl)methanone
phenyl-(5-pyridin-4-yl-1,3,4-oxadiazol-2-yl)methanone (PubChem CID 2338542) has the molecular formula C14H9N3O2
and a molecular weight of 251.25 g/mol. Its IUPAC name is phenyl-(5-pyridin-4-yl-1,3,4-oxadiazol-2-yl)methanone.
Molecular Properties
| Compound Name | phenyl-(5-pyridin-4-yl-1,3,4-oxadiazol-2-yl)methanone |
| PubChem CID | 2338542 |
| Molecular Formula | C14H9N3O2 |
| Molecular Weight | 251.25 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | phenyl-(5-pyridin-4-yl-1,3,4-oxadiazol-2-yl)methanone |
| SMILES | O=C(c1ccccc1)c1nnc(-c2ccncc2)o1 |
| InChI | InChI=1S/C14H9N3O2/c18-12(10-4-2-1-3-5-10)14-17-16-13(19-14)11-6-8-15-9-7-11/h1-9H |
| InChIKey | NPLYGIRPYYNAQH-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 68.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.25 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze phenyl-(5-pyridin-4-yl-1,3,4-oxadiazol-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl-(5-pyridin-4-yl-1,3,4-oxadiazol-2-yl)methanone?
The IUPAC name of phenyl-(5-pyridin-4-yl-1,3,4-oxadiazol-2-yl)methanone (CID 2338542) is phenyl-(5-pyridin-4-yl-1,3,4-oxadiazol-2-yl)methanone.
What is the SMILES notation for phenyl-(5-pyridin-4-yl-1,3,4-oxadiazol-2-yl)methanone?
The canonical SMILES for phenyl-(5-pyridin-4-yl-1,3,4-oxadiazol-2-yl)methanone is O=C(c1ccccc1)c1nnc(-c2ccncc2)o1.
What is the InChIKey of phenyl-(5-pyridin-4-yl-1,3,4-oxadiazol-2-yl)methanone?
The InChIKey is NPLYGIRPYYNAQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9N3O2/c18-12(10-4-2-1-3-5-10)14-17-16-13(19-14)11-6-8-15-9-7-11/h1-9H.
What are the key properties of phenyl-(5-pyridin-4-yl-1,3,4-oxadiazol-2-yl)methanone?
phenyl-(5-pyridin-4-yl-1,3,4-oxadiazol-2-yl)methanone has a molecular weight of 251.25 g/mol, XLogP of 2.36, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl-(5-pyridin-4-yl-1,3,4-oxadiazol-2-yl)methanone is sourced from PubChem (CID 2338542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).