About 2-methyl-4-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]benzenecarbothioamide
2-methyl-4-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]benzenecarbothioamide (PubChem CID 23386010) has the molecular formula C14H12F3N3O2S
and a molecular weight of 343.33 g/mol. Its IUPAC name is 2-methyl-4-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]benzenecarbothioamide.
Molecular Properties
| Compound Name | 2-methyl-4-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]benzenecarbothioamide |
| PubChem CID | 23386010 |
| Molecular Formula | C14H12F3N3O2S |
| Molecular Weight | 343.33 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | 2-methyl-4-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]benzenecarbothioamide |
| SMILES | Cc1cc(-n2c(=O)cc(C(F)(F)F)n(C)c2=O)ccc1C(N)=S |
| InChI | InChI=1S/C14H12F3N3O2S/c1-7-5-8(3-4-9(7)12(18)23)20-11(21)6-10(14(15,16)17)19(2)13(20)22/h3-6H,1-2H3,(H2,18,23) |
| InChIKey | IGSMPLVLGKLVST-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 70.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.33 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-4-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]benzenecarbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]benzenecarbothioamide?
The IUPAC name of 2-methyl-4-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]benzenecarbothioamide (CID 23386010) is 2-methyl-4-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]benzenecarbothioamide.
What is the SMILES notation for 2-methyl-4-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]benzenecarbothioamide?
The canonical SMILES for 2-methyl-4-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]benzenecarbothioamide is Cc1cc(-n2c(=O)cc(C(F)(F)F)n(C)c2=O)ccc1C(N)=S.
What is the InChIKey of 2-methyl-4-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]benzenecarbothioamide?
The InChIKey is IGSMPLVLGKLVST-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12F3N3O2S/c1-7-5-8(3-4-9(7)12(18)23)20-11(21)6-10(14(15,16)17)19(2)13(20)22/h3-6H,1-2H3,(H2,18,23).
What are the key properties of 2-methyl-4-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]benzenecarbothioamide?
2-methyl-4-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]benzenecarbothioamide has a molecular weight of 343.33 g/mol, XLogP of 1.50, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]benzenecarbothioamide is sourced from PubChem (CID 23386010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).