About 2-[2,3-bis[(2-hydrazinyl-2-oxoethyl)sulfanyl]propylsulfanyl]acetohydrazide
2-[2,3-bis[(2-hydrazinyl-2-oxoethyl)sulfanyl]propylsulfanyl]acetohydrazide (PubChem CID 23386225) has the molecular formula C9H20N6O3S3
and a molecular weight of 356.50 g/mol. Its IUPAC name is 2-[2,3-bis[(2-hydrazinyl-2-oxoethyl)sulfanyl]propylsulfanyl]acetohydrazide.
Molecular Properties
| Compound Name | 2-[2,3-bis[(2-hydrazinyl-2-oxoethyl)sulfanyl]propylsulfanyl]acetohydrazide |
| PubChem CID | 23386225 |
| Molecular Formula | C9H20N6O3S3 |
| Molecular Weight | 356.50 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | 2-[2,3-bis[(2-hydrazinyl-2-oxoethyl)sulfanyl]propylsulfanyl]acetohydrazide |
| SMILES | NNC(=O)CSCC(CSCC(=O)NN)SCC(=O)NN |
| InChI | InChI=1S/C9H20N6O3S3/c10-13-7(16)3-19-1-6(21-5-9(18)15-12)2-20-4-8(17)14-11/h6H,1-5,10-12H2,(H,13,16)(H,14,17)(H,15,18) |
| InChIKey | BDBSCGWSFMNJAU-UHFFFAOYSA-N |
| XLogP | -2.48 |
| TPSA | 165.36 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 356.50 |
| LogP ≤ 5 | -2.48 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[2,3-bis[(2-hydrazinyl-2-oxoethyl)sulfanyl]propylsulfanyl]acetohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2,3-bis[(2-hydrazinyl-2-oxoethyl)sulfanyl]propylsulfanyl]acetohydrazide?
The IUPAC name of 2-[2,3-bis[(2-hydrazinyl-2-oxoethyl)sulfanyl]propylsulfanyl]acetohydrazide (CID 23386225) is 2-[2,3-bis[(2-hydrazinyl-2-oxoethyl)sulfanyl]propylsulfanyl]acetohydrazide.
What is the SMILES notation for 2-[2,3-bis[(2-hydrazinyl-2-oxoethyl)sulfanyl]propylsulfanyl]acetohydrazide?
The canonical SMILES for 2-[2,3-bis[(2-hydrazinyl-2-oxoethyl)sulfanyl]propylsulfanyl]acetohydrazide is NNC(=O)CSCC(CSCC(=O)NN)SCC(=O)NN.
What is the InChIKey of 2-[2,3-bis[(2-hydrazinyl-2-oxoethyl)sulfanyl]propylsulfanyl]acetohydrazide?
The InChIKey is BDBSCGWSFMNJAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N6O3S3/c10-13-7(16)3-19-1-6(21-5-9(18)15-12)2-20-4-8(17)14-11/h6H,1-5,10-12H2,(H,13,16)(H,14,17)(H,15,18).
What are the key properties of 2-[2,3-bis[(2-hydrazinyl-2-oxoethyl)sulfanyl]propylsulfanyl]acetohydrazide?
2-[2,3-bis[(2-hydrazinyl-2-oxoethyl)sulfanyl]propylsulfanyl]acetohydrazide has a molecular weight of 356.50 g/mol, XLogP of -2.48, 11 rotatable bonds, 6 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,3-bis[(2-hydrazinyl-2-oxoethyl)sulfanyl]propylsulfanyl]acetohydrazide is sourced from PubChem (CID 23386225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).