C9H15N3O6 — CID 23386288
1,3,5-tris(methoxymethyl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 23386288) has the molecular formula C9H15N3O6 and a molecular weight of 261.23 g/mol. Its IUPAC name is 1,3,5-tris(methoxymethyl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1,3,5-tris(methoxymethyl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 23386288 |
| Molecular Formula | C9H15N3O6 |
| Molecular Weight | 261.23 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 1,3,5-tris(methoxymethyl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | COCn1c(=O)n(COC)c(=O)n(COC)c1=O |
| InChI | InChI=1S/C9H15N3O6/c1-16-4-10-7(13)11(5-17-2)9(15)12(6-18-3)8(10)14/h4-6H2,1-3H3 |
| InChIKey | OACFRAFZVCBNJA-UHFFFAOYSA-N |
| XLogP | -2.02 |
| TPSA | 93.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.23 |
| LogP ≤ 5 | -2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |