C19H12N2O2+2 — CID 23386731
2,2'-spirobi[3-oxa-1-azoniatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene] (PubChem CID 23386731) has the molecular formula C19H12N2O2+2 and a molecular weight of 300.32 g/mol. Its IUPAC name is 2,2'-spirobi[3-oxa-1-azoniatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene].
| Compound Name | 2,2'-spirobi[3-oxa-1-azoniatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene] |
|---|---|
| PubChem CID | 23386731 |
| Molecular Formula | C19H12N2O2+2 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 2,2'-spirobi[3-oxa-1-azoniatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene] |
| SMILES | c1cc2c3c(c1)ccc[n+]3C1(O2)Oc2cccc3ccc[n+]1c23 |
| InChI | InChI=1S/C19H12N2O2/c1-5-13-7-3-11-20-17(13)15(9-1)22-19(20)21-12-4-8-14-6-2-10-16(23-19)18(14)21/h1-12H/q+2 |
| InChIKey | FWCVVIYQHFRPDR-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 26.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|