About 2-(tribromomethylsulfonyl)-5-(trifluoromethyl)-1,3-benzothiazole
2-(tribromomethylsulfonyl)-5-(trifluoromethyl)-1,3-benzothiazole (PubChem CID 23386816) has the molecular formula C9H3Br3F3NO2S2
and a molecular weight of 517.97 g/mol. Its IUPAC name is 2-(tribromomethylsulfonyl)-5-(trifluoromethyl)-1,3-benzothiazole.
Molecular Properties
| Compound Name | 2-(tribromomethylsulfonyl)-5-(trifluoromethyl)-1,3-benzothiazole |
| PubChem CID | 23386816 |
| Molecular Formula | C9H3Br3F3NO2S2 |
| Molecular Weight | 517.97 g/mol |
| Exact Mass | 514.71 |
| IUPAC Name | 2-(tribromomethylsulfonyl)-5-(trifluoromethyl)-1,3-benzothiazole |
| SMILES | O=S(=O)(c1nc2cc(C(F)(F)F)ccc2s1)C(Br)(Br)Br |
| InChI | InChI=1S/C9H3Br3F3NO2S2/c10-9(11,12)20(17,18)7-16-5-3-4(8(13,14)15)1-2-6(5)19-7/h1-3H |
| InChIKey | KNNJUEAQNDXDOL-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 517.97 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(tribromomethylsulfonyl)-5-(trifluoromethyl)-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(tribromomethylsulfonyl)-5-(trifluoromethyl)-1,3-benzothiazole?
The IUPAC name of 2-(tribromomethylsulfonyl)-5-(trifluoromethyl)-1,3-benzothiazole (CID 23386816) is 2-(tribromomethylsulfonyl)-5-(trifluoromethyl)-1,3-benzothiazole.
What is the SMILES notation for 2-(tribromomethylsulfonyl)-5-(trifluoromethyl)-1,3-benzothiazole?
The canonical SMILES for 2-(tribromomethylsulfonyl)-5-(trifluoromethyl)-1,3-benzothiazole is O=S(=O)(c1nc2cc(C(F)(F)F)ccc2s1)C(Br)(Br)Br.
What is the InChIKey of 2-(tribromomethylsulfonyl)-5-(trifluoromethyl)-1,3-benzothiazole?
The InChIKey is KNNJUEAQNDXDOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H3Br3F3NO2S2/c10-9(11,12)20(17,18)7-16-5-3-4(8(13,14)15)1-2-6(5)19-7/h1-3H.
What are the key properties of 2-(tribromomethylsulfonyl)-5-(trifluoromethyl)-1,3-benzothiazole?
2-(tribromomethylsulfonyl)-5-(trifluoromethyl)-1,3-benzothiazole has a molecular weight of 517.97 g/mol, XLogP of 4.88, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(tribromomethylsulfonyl)-5-(trifluoromethyl)-1,3-benzothiazole is sourced from PubChem (CID 23386816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).