C55H66N4O5P2+2 — CID 23387091
[1-oxo-1-[3-[3-[3-[3-(2-triphenylphosphaniumylpropanoylamino)propoxy]propylcarbamoylamino]propoxy]propylamino]propan-2-yl]-triphenylphosphanium (PubChem CID 23387091) has the molecular formula C55H66N4O5P2+2 and a molecular weight of 925.10 g/mol. Its IUPAC name is [1-oxo-1-[3-[3-[3-[3-(2-triphenylphosphaniumylpropanoylamino)propoxy]propylcarbamoylamino]propoxy]propylamino]propan-2-yl]-triphenylphosphanium.
| Compound Name | [1-oxo-1-[3-[3-[3-[3-(2-triphenylphosphaniumylpropanoylamino)propoxy]propylcarbamoylamino]propoxy]propylamino]propan-2-yl]-triphenylphosphanium |
|---|---|
| PubChem CID | 23387091 |
| Molecular Formula | C55H66N4O5P2+2 |
| Molecular Weight | 925.10 g/mol |
| Exact Mass | 924.45 |
| IUPAC Name | [1-oxo-1-[3-[3-[3-[3-(2-triphenylphosphaniumylpropanoylamino)propoxy]propylcarbamoylamino]propoxy]propylamino]propan-2-yl]-triphenylphosphanium |
| SMILES | CC(C(=O)NCCCOCCCNC(=O)NCCCOCCCNC(=O)C(C)[P+](c1ccccc1)(c1ccccc1)c1ccccc1)[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C55H64N4O5P2/c1-45(65(47-25-9-3-10-26-47,48-27-11-4-12-28-48)49-29-13-5-14-30-49)53(60)56-37-21-41-63-43-23-39-58-55(62)59-40-24-44-64-42-22-38-57-54(61)46(2)66(50-31-15-6-16-32-50,51-33-17-7-18-34-51)52-35-19-8-20-36-52/h3-20,25-36,45-46H,21-24,37-44H2,1-2H3,(H2-2,56,57,58,59,60,61,62)/p+2 |
| InChIKey | MOODZYPRIRSWSJ-UHFFFAOYSA-P |
| XLogP | 6.88 |
| TPSA | 117.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 925.10 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|