C34H31N2OS2+ — CID 23387193
2-[(E)-[3-[(E,3Z)-3-(3,5-dimethyl-1,3-benzothiazol-2-ylidene)prop-1-enyl]-5-phenylcyclohex-2-en-1-ylidene]methyl]-9-oxa-3-thia-1-azoniatricyclo[6.3.1.04,12]dodeca-1,4,6,8(12)-tetraene (PubChem CID 23387193) has the molecular formula C34H31N2OS2+ and a molecular weight of 547.77 g/mol. Its IUPAC name is 2-[(E)-[3-[(E,3Z)-3-(3,5-dimethyl-1,3-benzothiazol-2-ylidene)prop-1-enyl]-5-phenylcyclohex-2-en-1-ylidene]methyl]-9-oxa-3-thia-1-azoniatricyclo[6.3.1.04,12]dodeca-1,4,6,8(12)-tetraene.
| Compound Name | 2-[(E)-[3-[(E,3Z)-3-(3,5-dimethyl-1,3-benzothiazol-2-ylidene)prop-1-enyl]-5-phenylcyclohex-2-en-1-ylidene]methyl]-9-oxa-3-thia-1-azoniatricyclo[6.3.1.04,12]dodeca-1,4,6,8(12)-tetraene |
|---|---|
| PubChem CID | 23387193 |
| Molecular Formula | C34H31N2OS2+ |
| Molecular Weight | 547.77 g/mol |
| Exact Mass | 547.19 |
| IUPAC Name | 2-[(E)-[3-[(E,3Z)-3-(3,5-dimethyl-1,3-benzothiazol-2-ylidene)prop-1-enyl]-5-phenylcyclohex-2-en-1-ylidene]methyl]-9-oxa-3-thia-1-azoniatricyclo[6.3.1.04,12]dodeca-1,4,6,8(12)-tetraene |
| SMILES | Cc1ccc2c(c1)N(C)/C(=C/C=C/C1=C/C(=C/c3sc4cccc5c4[n+]3CCO5)CC(c3ccccc3)C1)S2 |
| InChI | InChI=1S/C34H31N2OS2/c1-23-14-15-30-28(18-23)35(2)32(38-30)13-6-8-24-19-25(21-27(20-24)26-9-4-3-5-10-26)22-33-36-16-17-37-29-11-7-12-31(39-33)34(29)36/h3-15,18-19,22,27H,16-17,20-21H2,1-2H3/q+1 |
| InChIKey | GWLWHXIWZSXAFZ-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 16.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.77 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|