C24H47N3O5 — CID 23387269
propan-2-yl 10-[[6-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]decanoate (PubChem CID 23387269) has the molecular formula C24H47N3O5 and a molecular weight of 457.66 g/mol. Its IUPAC name is propan-2-yl 10-[[6-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]decanoate.
| Compound Name | propan-2-yl 10-[[6-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]decanoate |
|---|---|
| PubChem CID | 23387269 |
| Molecular Formula | C24H47N3O5 |
| Molecular Weight | 457.66 g/mol |
| Exact Mass | 457.35 |
| IUPAC Name | propan-2-yl 10-[[6-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]decanoate |
| SMILES | CC(C)OC(=O)CCCCCCCCCNC(=O)C(CCCCN)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H47N3O5/c1-19(2)31-21(28)16-11-9-7-6-8-10-14-18-26-22(29)20(15-12-13-17-25)27-23(30)32-24(3,4)5/h19-20H,6-18,25H2,1-5H3,(H,26,29)(H,27,30) |
| InChIKey | LAPXLDMDPMYWHV-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.66 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|