C23H25NO6 — CID 23387354
2-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]oxypropanoic acid (PubChem CID 23387354) has the molecular formula C23H25NO6 and a molecular weight of 411.45 g/mol. Its IUPAC name is 2-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]oxypropanoic acid.
| Compound Name | 2-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]oxypropanoic acid |
|---|---|
| PubChem CID | 23387354 |
| Molecular Formula | C23H25NO6 |
| Molecular Weight | 411.45 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | 2-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]oxypropanoic acid |
| SMILES | CC(OC(=O)[C@@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(C)C)C(=O)O |
| InChI | InChI=1S/C23H25NO6/c1-13(2)20(22(27)30-14(3)21(25)26)24-23(28)29-12-19-17-10-6-4-8-15(17)16-9-5-7-11-18(16)19/h4-11,13-14,19-20H,12H2,1-3H3,(H,24,28)(H,25,26)/t14?,20-/m0/s1 |
| InChIKey | HZASXZJNMNAFCO-LGTGAQBVSA-N |
| XLogP | 3.57 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.45 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |