C28H31N3O7S2 — CID 23387848
1-(2,3,5-trimethylphenoxy)carbonyloxyethyl (4S,5R,6S)-6-[(1R)-1-hydroxyethyl]-4-methyl-3-(7-methylsulfanylimidazo[5,1-b][1,3]thiazol-2-yl)-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate (PubChem CID 23387848) has the molecular formula C28H31N3O7S2 and a molecular weight of 585.70 g/mol. Its IUPAC name is 1-(2,3,5-trimethylphenoxy)carbonyloxyethyl (4S,5R,6S)-6-[(1R)-1-hydroxyethyl]-4-methyl-3-(7-methylsulfanylimidazo[5,1-b][1,3]thiazol-2-yl)-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate.
| Compound Name | 1-(2,3,5-trimethylphenoxy)carbonyloxyethyl (4S,5R,6S)-6-[(1R)-1-hydroxyethyl]-4-methyl-3-(7-methylsulfanylimidazo[5,1-b][1,3]thiazol-2-yl)-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 23387848 |
| Molecular Formula | C28H31N3O7S2 |
| Molecular Weight | 585.70 g/mol |
| Exact Mass | 585.16 |
| IUPAC Name | 1-(2,3,5-trimethylphenoxy)carbonyloxyethyl (4S,5R,6S)-6-[(1R)-1-hydroxyethyl]-4-methyl-3-(7-methylsulfanylimidazo[5,1-b][1,3]thiazol-2-yl)-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| SMILES | CSc1ncn2cc(C3=C(C(=O)OC(C)OC(=O)Oc4cc(C)cc(C)c4C)N4C(=O)[C@H]([C@@H](C)O)[C@H]4[C@H]3C)sc12 |
| InChI | InChI=1S/C28H31N3O7S2/c1-12-8-13(2)14(3)18(9-12)38-28(35)37-17(6)36-27(34)23-20(15(4)22-21(16(5)32)25(33)31(22)23)19-10-30-11-29-24(39-7)26(30)40-19/h8-11,15-17,21-22,32H,1-7H3/t15-,16+,17?,21+,22+/m0/s1 |
| InChIKey | WWQFOAWALXJDHB-BOSIDTNXSA-N |
| XLogP | 4.72 |
| TPSA | 119.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.70 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|