C27H29N3O9S2 — CID 23387853
1-(2,6-dimethylphenoxy)carbonyloxyethyl (4S,5R,6S)-6-[(1R)-1-hydroxyethyl]-4-methyl-3-(7-methylsulfonylimidazo[5,1-b][1,3]thiazol-2-yl)-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate (PubChem CID 23387853) has the molecular formula C27H29N3O9S2 and a molecular weight of 603.68 g/mol. Its IUPAC name is 1-(2,6-dimethylphenoxy)carbonyloxyethyl (4S,5R,6S)-6-[(1R)-1-hydroxyethyl]-4-methyl-3-(7-methylsulfonylimidazo[5,1-b][1,3]thiazol-2-yl)-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate.
| Compound Name | 1-(2,6-dimethylphenoxy)carbonyloxyethyl (4S,5R,6S)-6-[(1R)-1-hydroxyethyl]-4-methyl-3-(7-methylsulfonylimidazo[5,1-b][1,3]thiazol-2-yl)-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 23387853 |
| Molecular Formula | C27H29N3O9S2 |
| Molecular Weight | 603.68 g/mol |
| Exact Mass | 603.13 |
| IUPAC Name | 1-(2,6-dimethylphenoxy)carbonyloxyethyl (4S,5R,6S)-6-[(1R)-1-hydroxyethyl]-4-methyl-3-(7-methylsulfonylimidazo[5,1-b][1,3]thiazol-2-yl)-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| SMILES | Cc1cccc(C)c1OC(=O)OC(C)OC(=O)C1=C(c2cn3cnc(S(C)(=O)=O)c3s2)[C@H](C)[C@@H]2[C@@H]([C@@H](C)O)C(=O)N12 |
| InChI | InChI=1S/C27H29N3O9S2/c1-12-8-7-9-13(2)22(12)39-27(34)38-16(5)37-26(33)21-18(14(3)20-19(15(4)31)24(32)30(20)21)17-10-29-11-28-23(25(29)40-17)41(6,35)36/h7-11,14-16,19-20,31H,1-6H3/t14-,15+,16?,19+,20+/m0/s1 |
| InChIKey | OJOWMDRKFGOYOE-VHEJKYQMSA-N |
| XLogP | 3.09 |
| TPSA | 153.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.68 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|