C24H30N4O7S — CID 23388040
2,2-dimethylpropanoyloxymethyl (4S,5R,6S)-3-[7-(acetamidomethyl)imidazo[5,1-b][1,3]thiazol-2-yl]-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate (PubChem CID 23388040) has the molecular formula C24H30N4O7S and a molecular weight of 518.59 g/mol. Its IUPAC name is 2,2-dimethylpropanoyloxymethyl (4S,5R,6S)-3-[7-(acetamidomethyl)imidazo[5,1-b][1,3]thiazol-2-yl]-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate.
| Compound Name | 2,2-dimethylpropanoyloxymethyl (4S,5R,6S)-3-[7-(acetamidomethyl)imidazo[5,1-b][1,3]thiazol-2-yl]-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 23388040 |
| Molecular Formula | C24H30N4O7S |
| Molecular Weight | 518.59 g/mol |
| Exact Mass | 518.18 |
| IUPAC Name | 2,2-dimethylpropanoyloxymethyl (4S,5R,6S)-3-[7-(acetamidomethyl)imidazo[5,1-b][1,3]thiazol-2-yl]-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| SMILES | CC(=O)NCc1ncn2cc(C3=C(C(=O)OCOC(=O)C(C)(C)C)N4C(=O)[C@H]([C@@H](C)O)[C@H]4[C@H]3C)sc12 |
| InChI | InChI=1S/C24H30N4O7S/c1-11-16(15-8-27-9-26-14(21(27)36-15)7-25-13(3)30)19(28-18(11)17(12(2)29)20(28)31)22(32)34-10-35-23(33)24(4,5)6/h8-9,11-12,17-18,29H,7,10H2,1-6H3,(H,25,30)/t11-,12+,17+,18+/m0/s1 |
| InChIKey | JSFQAUNPNIJTST-PCHOHSICSA-N |
| XLogP | 1.69 |
| TPSA | 139.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.59 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|