About 3-[(2,4-difluorophenyl)methylideneamino]-N-ethyl-4-(4-methylphenyl)-1,3-thiazol-2-imine
3-[(2,4-difluorophenyl)methylideneamino]-N-ethyl-4-(4-methylphenyl)-1,3-thiazol-2-imine (PubChem CID 2338816) has the molecular formula C19H17F2N3S
and a molecular weight of 357.43 g/mol. Its IUPAC name is 3-[(2,4-difluorophenyl)methylideneamino]-N-ethyl-4-(4-methylphenyl)-1,3-thiazol-2-imine.
Molecular Properties
| Compound Name | 3-[(2,4-difluorophenyl)methylideneamino]-N-ethyl-4-(4-methylphenyl)-1,3-thiazol-2-imine |
| PubChem CID | 2338816 |
| Molecular Formula | C19H17F2N3S |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | 3-[(2,4-difluorophenyl)methylideneamino]-N-ethyl-4-(4-methylphenyl)-1,3-thiazol-2-imine |
| SMILES | CC/N=c1\scc(-c2ccc(C)cc2)n1N=Cc1ccc(F)cc1F |
| InChI | InChI=1S/C19H17F2N3S/c1-3-22-19-24(23-11-15-8-9-16(20)10-17(15)21)18(12-25-19)14-6-4-13(2)5-7-14/h4-12H,3H2,1-2H3/b22-19-,23-11? |
| InChIKey | WICRPQVOUDEMNJ-ZPHUFRHYSA-N |
| XLogP | 4.61 |
| TPSA | 29.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2,4-difluorophenyl)methylideneamino]-N-ethyl-4-(4-methylphenyl)-1,3-thiazol-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2,4-difluorophenyl)methylideneamino]-N-ethyl-4-(4-methylphenyl)-1,3-thiazol-2-imine?
The IUPAC name of 3-[(2,4-difluorophenyl)methylideneamino]-N-ethyl-4-(4-methylphenyl)-1,3-thiazol-2-imine (CID 2338816) is 3-[(2,4-difluorophenyl)methylideneamino]-N-ethyl-4-(4-methylphenyl)-1,3-thiazol-2-imine.
What is the SMILES notation for 3-[(2,4-difluorophenyl)methylideneamino]-N-ethyl-4-(4-methylphenyl)-1,3-thiazol-2-imine?
The canonical SMILES for 3-[(2,4-difluorophenyl)methylideneamino]-N-ethyl-4-(4-methylphenyl)-1,3-thiazol-2-imine is CC/N=c1\scc(-c2ccc(C)cc2)n1N=Cc1ccc(F)cc1F.
What is the InChIKey of 3-[(2,4-difluorophenyl)methylideneamino]-N-ethyl-4-(4-methylphenyl)-1,3-thiazol-2-imine?
The InChIKey is WICRPQVOUDEMNJ-ZPHUFRHYSA-N. The full InChI is InChI=1S/C19H17F2N3S/c1-3-22-19-24(23-11-15-8-9-16(20)10-17(15)21)18(12-25-19)14-6-4-13(2)5-7-14/h4-12H,3H2,1-2H3/b22-19-,23-11?.
What are the key properties of 3-[(2,4-difluorophenyl)methylideneamino]-N-ethyl-4-(4-methylphenyl)-1,3-thiazol-2-imine?
3-[(2,4-difluorophenyl)methylideneamino]-N-ethyl-4-(4-methylphenyl)-1,3-thiazol-2-imine has a molecular weight of 357.43 g/mol, XLogP of 4.61, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,4-difluorophenyl)methylideneamino]-N-ethyl-4-(4-methylphenyl)-1,3-thiazol-2-imine is sourced from PubChem (CID 2338816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).