About N-[4,4-bis(4-fluorophenyl)butyl]-4-methyl-2-[methyl(oxan-4-yl)amino]pentanamide
N-[4,4-bis(4-fluorophenyl)butyl]-4-methyl-2-[methyl(oxan-4-yl)amino]pentanamide (PubChem CID 23388428) has the molecular formula C28H38F2N2O2
and a molecular weight of 472.62 g/mol. Its IUPAC name is N-[4,4-bis(4-fluorophenyl)butyl]-4-methyl-2-[methyl(oxan-4-yl)amino]pentanamide.
Molecular Properties
| Compound Name | N-[4,4-bis(4-fluorophenyl)butyl]-4-methyl-2-[methyl(oxan-4-yl)amino]pentanamide |
| PubChem CID | 23388428 |
| Molecular Formula | C28H38F2N2O2 |
| Molecular Weight | 472.62 g/mol |
| Exact Mass | 472.29 |
| IUPAC Name | N-[4,4-bis(4-fluorophenyl)butyl]-4-methyl-2-[methyl(oxan-4-yl)amino]pentanamide |
| SMILES | CC(C)CC(C(=O)NCCCC(c1ccc(F)cc1)c1ccc(F)cc1)N(C)C1CCOCC1 |
| InChI | InChI=1S/C28H38F2N2O2/c1-20(2)19-27(32(3)25-14-17-34-18-15-25)28(33)31-16-4-5-26(21-6-10-23(29)11-7-21)22-8-12-24(30)13-9-22/h6-13,20,25-27H,4-5,14-19H2,1-3H3,(H,31,33) |
| InChIKey | HOBCGWLTRQGAKQ-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 472.62 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[4,4-bis(4-fluorophenyl)butyl]-4-methyl-2-[methyl(oxan-4-yl)amino]pentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4,4-bis(4-fluorophenyl)butyl]-4-methyl-2-[methyl(oxan-4-yl)amino]pentanamide?
The IUPAC name of N-[4,4-bis(4-fluorophenyl)butyl]-4-methyl-2-[methyl(oxan-4-yl)amino]pentanamide (CID 23388428) is N-[4,4-bis(4-fluorophenyl)butyl]-4-methyl-2-[methyl(oxan-4-yl)amino]pentanamide.
What is the SMILES notation for N-[4,4-bis(4-fluorophenyl)butyl]-4-methyl-2-[methyl(oxan-4-yl)amino]pentanamide?
The canonical SMILES for N-[4,4-bis(4-fluorophenyl)butyl]-4-methyl-2-[methyl(oxan-4-yl)amino]pentanamide is CC(C)CC(C(=O)NCCCC(c1ccc(F)cc1)c1ccc(F)cc1)N(C)C1CCOCC1.
What is the InChIKey of N-[4,4-bis(4-fluorophenyl)butyl]-4-methyl-2-[methyl(oxan-4-yl)amino]pentanamide?
The InChIKey is HOBCGWLTRQGAKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H38F2N2O2/c1-20(2)19-27(32(3)25-14-17-34-18-15-25)28(33)31-16-4-5-26(21-6-10-23(29)11-7-21)22-8-12-24(30)13-9-22/h6-13,20,25-27H,4-5,14-19H2,1-3H3,(H,31,33).
What are the key properties of N-[4,4-bis(4-fluorophenyl)butyl]-4-methyl-2-[methyl(oxan-4-yl)amino]pentanamide?
N-[4,4-bis(4-fluorophenyl)butyl]-4-methyl-2-[methyl(oxan-4-yl)amino]pentanamide has a molecular weight of 472.62 g/mol, XLogP of 5.52, 11 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4,4-bis(4-fluorophenyl)butyl]-4-methyl-2-[methyl(oxan-4-yl)amino]pentanamide is sourced from PubChem (CID 23388428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).