About ethylidenevanadium;3-methylpent-3-en-2-ylidenetungsten
ethylidenevanadium;3-methylpent-3-en-2-ylidenetungsten (PubChem CID 23389048) has the molecular formula C8H12VW-2
and a molecular weight of 342.97 g/mol. Its IUPAC name is ethylidenevanadium;3-methylpent-3-en-2-ylidenetungsten.
Molecular Properties
| Compound Name | ethylidenevanadium;3-methylpent-3-en-2-ylidenetungsten |
| PubChem CID | 23389048 |
| Molecular Formula | C8H12VW-2 |
| Molecular Weight | 342.97 g/mol |
| Exact Mass | 342.99 |
| IUPAC Name | ethylidenevanadium;3-methylpent-3-en-2-ylidenetungsten |
| SMILES | C/[C-]=C(\C)C(C)=[W].C[C-]=[V] |
| InChI | InChI=1S/C6H9.C2H3.V.W/c1-4-6(3)5-2;1-2;;/h1-3H3;1H3;;/q2*-1;; |
| InChIKey | JDHJRLHSKHQETB-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.97 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze ethylidenevanadium;3-methylpent-3-en-2-ylidenetungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethylidenevanadium;3-methylpent-3-en-2-ylidenetungsten?
The IUPAC name of ethylidenevanadium;3-methylpent-3-en-2-ylidenetungsten (CID 23389048) is ethylidenevanadium;3-methylpent-3-en-2-ylidenetungsten.
What is the SMILES notation for ethylidenevanadium;3-methylpent-3-en-2-ylidenetungsten?
The canonical SMILES for ethylidenevanadium;3-methylpent-3-en-2-ylidenetungsten is C/[C-]=C(\C)C(C)=[W].C[C-]=[V].
What is the InChIKey of ethylidenevanadium;3-methylpent-3-en-2-ylidenetungsten?
The InChIKey is JDHJRLHSKHQETB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9.C2H3.V.W/c1-4-6(3)5-2;1-2;;/h1-3H3;1H3;;/q2*-1;;.
What are the key properties of ethylidenevanadium;3-methylpent-3-en-2-ylidenetungsten?
ethylidenevanadium;3-methylpent-3-en-2-ylidenetungsten has a molecular weight of 342.97 g/mol, XLogP of 1.73, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethylidenevanadium;3-methylpent-3-en-2-ylidenetungsten is sourced from PubChem (CID 23389048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).