C25H24F6O5S — CID 23389260
3-[(2R,3R,4R)-2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-phenyloxan-4-yl]prop-2-ynyl methanesulfonate (PubChem CID 23389260) has the molecular formula C25H24F6O5S and a molecular weight of 550.52 g/mol. Its IUPAC name is 3-[(2R,3R,4R)-2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-phenyloxan-4-yl]prop-2-ynyl methanesulfonate.
| Compound Name | 3-[(2R,3R,4R)-2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-phenyloxan-4-yl]prop-2-ynyl methanesulfonate |
|---|---|
| PubChem CID | 23389260 |
| Molecular Formula | C25H24F6O5S |
| Molecular Weight | 550.52 g/mol |
| Exact Mass | 550.12 |
| IUPAC Name | 3-[(2R,3R,4R)-2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-phenyloxan-4-yl]prop-2-ynyl methanesulfonate |
| SMILES | CC(O[C@H]1OCC[C@@H](C#CCOS(C)(=O)=O)C1c1ccccc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H24F6O5S/c1-16(19-13-20(24(26,27)28)15-21(14-19)25(29,30)31)36-23-22(17-7-4-3-5-8-17)18(10-12-34-23)9-6-11-35-37(2,32)33/h3-5,7-8,13-16,18,22-23H,10-12H2,1-2H3/t16?,18-,22?,23-/m1/s1 |
| InChIKey | LVNUSMMYVZDUQN-NITVQUNTSA-N |
| XLogP | 5.93 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.52 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|