About (4-nitrophenyl) propan-2-yl carbonate
(4-nitrophenyl) propan-2-yl carbonate (PubChem CID 23390373) has the molecular formula C10H11NO5
and a molecular weight of 225.20 g/mol. Its IUPAC name is (4-nitrophenyl) propan-2-yl carbonate.
Molecular Properties
| Compound Name | (4-nitrophenyl) propan-2-yl carbonate |
| PubChem CID | 23390373 |
| Molecular Formula | C10H11NO5 |
| Molecular Weight | 225.20 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | (4-nitrophenyl) propan-2-yl carbonate |
| SMILES | CC(C)OC(=O)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C10H11NO5/c1-7(2)15-10(12)16-9-5-3-8(4-6-9)11(13)14/h3-7H,1-2H3 |
| InChIKey | XQFXJZPGQGFVLI-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.20 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze (4-nitrophenyl) propan-2-yl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-nitrophenyl) propan-2-yl carbonate?
The IUPAC name of (4-nitrophenyl) propan-2-yl carbonate (CID 23390373) is (4-nitrophenyl) propan-2-yl carbonate.
What is the SMILES notation for (4-nitrophenyl) propan-2-yl carbonate?
The canonical SMILES for (4-nitrophenyl) propan-2-yl carbonate is CC(C)OC(=O)Oc1ccc([N+](=O)[O-])cc1.
What is the InChIKey of (4-nitrophenyl) propan-2-yl carbonate?
The InChIKey is XQFXJZPGQGFVLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO5/c1-7(2)15-10(12)16-9-5-3-8(4-6-9)11(13)14/h3-7H,1-2H3.
What are the key properties of (4-nitrophenyl) propan-2-yl carbonate?
(4-nitrophenyl) propan-2-yl carbonate has a molecular weight of 225.20 g/mol, XLogP of 2.52, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-nitrophenyl) propan-2-yl carbonate is sourced from PubChem (CID 23390373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).