C10H18N2O2 — CID 23390379
1,4-dihydroxy-2,2,6,6-tetramethylpiperidine-4-carbonitrile (PubChem CID 23390379) has the molecular formula C10H18N2O2 and a molecular weight of 198.27 g/mol. Its IUPAC name is 1,4-dihydroxy-2,2,6,6-tetramethylpiperidine-4-carbonitrile.
| Compound Name | 1,4-dihydroxy-2,2,6,6-tetramethylpiperidine-4-carbonitrile |
|---|---|
| PubChem CID | 23390379 |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 1,4-dihydroxy-2,2,6,6-tetramethylpiperidine-4-carbonitrile |
| SMILES | CC1(C)CC(O)(C#N)CC(C)(C)N1O |
| InChI | InChI=1S/C10H18N2O2/c1-8(2)5-10(13,7-11)6-9(3,4)12(8)14/h13-14H,5-6H2,1-4H3 |
| InChIKey | VREYEUFQVKYNBT-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 67.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|