C10H20N2O3 — CID 23390380
1,4-dihydroxy-2,2,6,6-tetramethylpiperidine-4-carboxamide (PubChem CID 23390380) has the molecular formula C10H20N2O3 and a molecular weight of 216.28 g/mol. Its IUPAC name is 1,4-dihydroxy-2,2,6,6-tetramethylpiperidine-4-carboxamide.
| Compound Name | 1,4-dihydroxy-2,2,6,6-tetramethylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 23390380 |
| Molecular Formula | C10H20N2O3 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | 1,4-dihydroxy-2,2,6,6-tetramethylpiperidine-4-carboxamide |
| SMILES | CC1(C)CC(O)(C(N)=O)CC(C)(C)N1O |
| InChI | InChI=1S/C10H20N2O3/c1-8(2)5-10(14,7(11)13)6-9(3,4)12(8)15/h14-15H,5-6H2,1-4H3,(H2,11,13) |
| InChIKey | JJRDPTATKVNJLH-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |