C19H23F13O4 — CID 23390666
1-O-methyl 5-O-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl) 2-ethyl-2,4,4-trimethylpentanedioate (PubChem CID 23390666) has the molecular formula C19H23F13O4 and a molecular weight of 562.36 g/mol. Its IUPAC name is 1-O-methyl 5-O-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl) 2-ethyl-2,4,4-trimethylpentanedioate.
| Compound Name | 1-O-methyl 5-O-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl) 2-ethyl-2,4,4-trimethylpentanedioate |
|---|---|
| PubChem CID | 23390666 |
| Molecular Formula | C19H23F13O4 |
| Molecular Weight | 562.36 g/mol |
| Exact Mass | 562.14 |
| IUPAC Name | 1-O-methyl 5-O-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl) 2-ethyl-2,4,4-trimethylpentanedioate |
| SMILES | CCC(C)(CC(C)(C)C(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(=O)OC |
| InChI | InChI=1S/C19H23F13O4/c1-6-13(4,11(34)35-5)9-12(2,3)10(33)36-8-7-14(20,21)15(22,23)16(24,25)17(26,27)18(28,29)19(30,31)32/h6-9H2,1-5H3 |
| InChIKey | GZZZOKRPSNOFHV-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.36 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|