C22H27N7O5S2 — CID 23390914
cyanomethyl 3-[3-acetamido-4-[[5-(2-ethoxy-2-oxoethyl)sulfanyl-1,3,4-thiadiazol-2-yl]diazenyl]-N-ethylanilino]butanoate (PubChem CID 23390914) has the molecular formula C22H27N7O5S2 and a molecular weight of 533.64 g/mol. Its IUPAC name is cyanomethyl 3-[3-acetamido-4-[[5-(2-ethoxy-2-oxoethyl)sulfanyl-1,3,4-thiadiazol-2-yl]diazenyl]-N-ethylanilino]butanoate.
| Compound Name | cyanomethyl 3-[3-acetamido-4-[[5-(2-ethoxy-2-oxoethyl)sulfanyl-1,3,4-thiadiazol-2-yl]diazenyl]-N-ethylanilino]butanoate |
|---|---|
| PubChem CID | 23390914 |
| Molecular Formula | C22H27N7O5S2 |
| Molecular Weight | 533.64 g/mol |
| Exact Mass | 533.15 |
| IUPAC Name | cyanomethyl 3-[3-acetamido-4-[[5-(2-ethoxy-2-oxoethyl)sulfanyl-1,3,4-thiadiazol-2-yl]diazenyl]-N-ethylanilino]butanoate |
| SMILES | CCOC(=O)CSc1nnc(/N=N/c2ccc(N(CC)C(C)CC(=O)OCC#N)cc2NC(C)=O)s1 |
| InChI | InChI=1S/C22H27N7O5S2/c1-5-29(14(3)11-19(31)34-10-9-23)16-7-8-17(18(12-16)24-15(4)30)25-26-21-27-28-22(36-21)35-13-20(32)33-6-2/h7-8,12,14H,5-6,10-11,13H2,1-4H3,(H,24,30)/b26-25+ |
| InChIKey | DSFVDNZLPRIBHN-OCEACIFDSA-N |
| XLogP | 4.24 |
| TPSA | 159.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.64 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|