C20H26N6O3S2 — CID 23390916
ethyl 2-[[5-[[2-acetamido-4-[propan-2-yl(prop-2-enyl)amino]phenyl]diazenyl]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate (PubChem CID 23390916) has the molecular formula C20H26N6O3S2 and a molecular weight of 462.60 g/mol. Its IUPAC name is ethyl 2-[[5-[[2-acetamido-4-[propan-2-yl(prop-2-enyl)amino]phenyl]diazenyl]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate.
| Compound Name | ethyl 2-[[5-[[2-acetamido-4-[propan-2-yl(prop-2-enyl)amino]phenyl]diazenyl]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 23390916 |
| Molecular Formula | C20H26N6O3S2 |
| Molecular Weight | 462.60 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | ethyl 2-[[5-[[2-acetamido-4-[propan-2-yl(prop-2-enyl)amino]phenyl]diazenyl]-1,3,4-thiadiazol-2-yl]sulfanyl]acetate |
| SMILES | C=CCN(c1ccc(/N=N/c2nnc(SCC(=O)OCC)s2)c(NC(C)=O)c1)C(C)C |
| InChI | InChI=1S/C20H26N6O3S2/c1-6-10-26(13(3)4)15-8-9-16(17(11-15)21-14(5)27)22-23-19-24-25-20(31-19)30-12-18(28)29-7-2/h6,8-9,11,13H,1,7,10,12H2,2-5H3,(H,21,27)/b23-22+ |
| InChIKey | RTUMXOCOCMAJGB-GHVJWSGMSA-N |
| XLogP | 4.97 |
| TPSA | 109.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.60 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|