C24H38N6O4S2 — CID 23390921
N-[5-[butan-2-yl(propyl)amino]-2-[[5-[2-[2-(2-methoxyethoxy)ethoxy]ethylsulfanyl]-1,3,4-thiadiazol-2-yl]diazenyl]phenyl]acetamide (PubChem CID 23390921) has the molecular formula C24H38N6O4S2 and a molecular weight of 538.74 g/mol. Its IUPAC name is N-[5-[butan-2-yl(propyl)amino]-2-[[5-[2-[2-(2-methoxyethoxy)ethoxy]ethylsulfanyl]-1,3,4-thiadiazol-2-yl]diazenyl]phenyl]acetamide.
| Compound Name | N-[5-[butan-2-yl(propyl)amino]-2-[[5-[2-[2-(2-methoxyethoxy)ethoxy]ethylsulfanyl]-1,3,4-thiadiazol-2-yl]diazenyl]phenyl]acetamide |
|---|---|
| PubChem CID | 23390921 |
| Molecular Formula | C24H38N6O4S2 |
| Molecular Weight | 538.74 g/mol |
| Exact Mass | 538.24 |
| IUPAC Name | N-[5-[butan-2-yl(propyl)amino]-2-[[5-[2-[2-(2-methoxyethoxy)ethoxy]ethylsulfanyl]-1,3,4-thiadiazol-2-yl]diazenyl]phenyl]acetamide |
| SMILES | CCCN(c1ccc(/N=N/c2nnc(SCCOCCOCCOC)s2)c(NC(C)=O)c1)C(C)CC |
| InChI | InChI=1S/C24H38N6O4S2/c1-6-10-30(18(3)7-2)20-8-9-21(22(17-20)25-19(4)31)26-27-23-28-29-24(36-23)35-16-15-34-14-13-33-12-11-32-5/h8-9,17-18H,6-7,10-16H2,1-5H3,(H,25,31)/b27-26+ |
| InChIKey | VBIYHZPCCRPBNT-CYYJNZCTSA-N |
| XLogP | 5.70 |
| TPSA | 110.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.74 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|