C18H23N7O2S2 — CID 23390923
N-[5-[butan-2-yl(2-hydroxyethyl)amino]-2-[[5-(isocyanomethylsulfanyl)-1,3,4-thiadiazol-2-yl]diazenyl]phenyl]acetamide (PubChem CID 23390923) has the molecular formula C18H23N7O2S2 and a molecular weight of 433.56 g/mol. Its IUPAC name is N-[5-[butan-2-yl(2-hydroxyethyl)amino]-2-[[5-(isocyanomethylsulfanyl)-1,3,4-thiadiazol-2-yl]diazenyl]phenyl]acetamide.
| Compound Name | N-[5-[butan-2-yl(2-hydroxyethyl)amino]-2-[[5-(isocyanomethylsulfanyl)-1,3,4-thiadiazol-2-yl]diazenyl]phenyl]acetamide |
|---|---|
| PubChem CID | 23390923 |
| Molecular Formula | C18H23N7O2S2 |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | N-[5-[butan-2-yl(2-hydroxyethyl)amino]-2-[[5-(isocyanomethylsulfanyl)-1,3,4-thiadiazol-2-yl]diazenyl]phenyl]acetamide |
| SMILES | [C-]#[N+]CSc1nnc(/N=N/c2ccc(N(CCO)C(C)CC)cc2NC(C)=O)s1 |
| InChI | InChI=1S/C18H23N7O2S2/c1-5-12(2)25(8-9-26)14-6-7-15(16(10-14)20-13(3)27)21-22-17-23-24-18(29-17)28-11-19-4/h6-7,10,12,26H,5,8-9,11H2,1-3H3,(H,20,27)/b22-21+ |
| InChIKey | XVVZCNORKHKJPE-QURGRASLSA-N |
| XLogP | 4.48 |
| TPSA | 107.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|